CAS 618383-01-0

3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenyl-1H-pyrazole-5-carboxylic acid

Description:

3-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-phenyl-1H-pyrazole-5-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a phenyl group, and a benzodioxin moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and pharmacology. The presence of the carboxylic acid functional group suggests it may participate in hydrogen bonding and ionic interactions, influencing its reactivity and solubility in aqueous environments. Its unique structure may confer specific biological activities, potentially making it a candidate for drug development. Additionally, the compound's molecular weight and specific stereochemistry can affect its pharmacokinetics and pharmacodynamics. As with many organic compounds, stability under various conditions, such as temperature and pH, is also a critical characteristic to consider in its applications. Overall, this compound represents a fascinating area of study within the field of organic and medicinal chemistry.

Formula: C₁₈H₁₄N₂O₄

InChI: InChI=1/C18H14N2O4/c21-18(22)15-11-14(19-20(15)13-4-2-1-3-5-13)12-6-7-16-17(10-12)24-9-8-23-16/h1-7,10-11H,8-9H2,(H,21,22)

SMILES: c1ccc(cc1)n1c(cc(c2ccc3c(c2)OCCO3)n1)C(=O)O

Synonyms:

• 1H-Pyrazole-5-carboxylic acid, 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenyl-
• 3-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1-phenyl-1H-pyrazole-5-carboxylic acid

3-(2,3-Dihydro-benzo[1,4]dioxin-6-yl)-1-phenyl-1H-pyrazole-5-carboxylic acid

CAS: 618383-01-0

Molecular weight: 322.32000732421875

Ref: 10-F023838