CAS 618383-09-8

1-(4-chlorophenyl)-3-[4-(methylsulfanyl)phenyl]-1H-pyrazole-5-carboxylic acid

Description:

1-(4-Chlorophenyl)-3-[4-(methylsulfanyl)phenyl]-1H-pyrazole-5-carboxylic acid, with the CAS number 618383-09-8, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of a 4-chlorophenyl group and a 4-(methylsulfanyl)phenyl group indicates that it has significant aromatic character, which can influence its reactivity and interactions with biological systems. The methylsulfanyl group introduces a sulfur atom, which can enhance the compound's lipophilicity and potentially its biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in areas targeting specific biological pathways. As with many organic compounds, its solubility, stability, and reactivity will depend on environmental conditions such as pH and temperature.

Formula: C₁₇H₁₃ClN₂O₂S

InChI: InChI=1/C17H13ClN2O2S/c1-23-14-8-2-11(3-9-14)15-10-16(17(21)22)20(19-15)13-6-4-12(18)5-7-13/h2-10H,1H3,(H,21,22)

SMILES: CSc1ccc(cc1)c1cc(C(=O)O)n(c2ccc(cc2)Cl)n1

Synonyms:

• 1H-Pyrazole-5-carboxylic acid, 1-(4-chlorophenyl)-3-[4-(methylthio)phenyl]-
• 1-(4-Chlorophenyl)-3-[4-(methylsulfanyl)phenyl]-1H-pyrazole-5-carboxylic acid

1-(4-Chloro-phenyl)-3-(4-methylsulfanyl-phenyl)-1H-pyrazole-5-carboxylic acid

CAS: 618383-09-8

Molecular weight: 344.80999755859375

Ref: 10-F023840