CAS 618446-34-7

4-(Aminomethyl)-2-pyridinamine dihydrochloride

Description:

4-(Aminomethyl)-2-pyridinamine dihydrochloride, with the CAS number 618446-34-7, is a chemical compound characterized by its pyridine ring structure, which is substituted with an aminomethyl group and an amino group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the dihydrochloride salt form, which enhances its solubility and stability. It is often used in pharmaceutical research and development, particularly in the synthesis of various biologically active molecules. The presence of amino groups in its structure suggests potential for hydrogen bonding and reactivity, making it a valuable intermediate in organic synthesis. Additionally, its properties may include moderate to high melting points and specific reactivity patterns typical of amines and pyridine derivatives. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.

Formula: C₆H₁₁Cl₂N₃

InChI: InChI=1S/C6H9N3.2ClH/c7-4-5-1-2-9-6(8)3-5;;/h1-3H,4,7H2,(H2,8,9);2*1H

SMILES: c1c[nH]c(=N)cc1CN.Cl.Cl

Synonyms:

• 4-(AMinoMethyl)pyridin-2-aMine dihydrochloride

4-(Aminomethyl)pyridin-2-amine dihydrochloride

CAS: 618446-34-7

Formula: C₆H₁₁Cl₂N₃

Molecular weight: 196.0776

Ref: IN-DA00EKTM

2-Amino-4-(aminomethyl)pyridine dihydrochloride

CAS: 618446-34-7

2-Amino-4-(aminomethyl)pyridine dihydrochloride

Purity: ≥95%

Molecular weight: 196.08g/mol

Ref: 54-OR470543