CAS 61845-39-4
:thymidylyl(3'5')-2'-deoxyadenosine*ammonium
Description:
Thymidylyl(3'5')-2'-deoxyadenosine ammonium, also known by its CAS number 61845-39-4, is a nucleotide analog that plays a significant role in biochemical research, particularly in studies involving nucleic acids. This compound consists of a thymidine moiety linked to a deoxyadenosine unit through a phosphodiester bond, specifically in a 3',5'-linkage configuration. The presence of the ammonium group suggests that it may exist in a protonated form, which can influence its solubility and interaction with biological macromolecules. This substance is typically used in the synthesis of oligonucleotides and can serve as a substrate for various enzymatic reactions, including those catalyzed by polymerases. Its structural characteristics allow it to participate in base pairing and hybridization processes, making it valuable in molecular biology applications such as PCR and DNA sequencing. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and ionic strength, which are critical for its functionality in biological systems.
Formula:C20H29N8O10P
InChI:InChI=1/C20H26N7O10P.H3N/c1-9-4-26(20(31)25-19(9)30)15-3-11(12(5-28)35-15)37-38(32,33)34-6-13-10(29)2-14(36-13)27-8-24-16-17(21)22-7-23-18(16)27;/h4,7-8,10-15,28-29H,2-3,5-6H2,1H3,(H,32,33)(H2,21,22,23)(H,25,30,31);1H3
SMILES:Cc1cn(C2CC(C(CO)O2)OP(=O)(O)OCC2C(CC(n3cnc4c(N)ncnc34)O2)O)c(=O)nc1O.N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Thymidylyl-(3''-5'')-2''-deoxyadenosine ammonium salt
CAS:Formula:C20H24N7O10PNH3Molecular weight:570.45Thymidylyl-(3'-5')-2'-deoxyadenosine ammonium salt
CAS:Thymidylyl-(3'-5')-2'-deoxyadenosine ammonium salt is a nucleoside that is a synthetic analog of thymidine. It has antiviral activity and is used in the synthesis of DNA and RNA. This product has shown to be effective against HIV, influenza, polio, herpes, and human papillomavirus. Thymidylyl-(3'-5')-2'-deoxyadenosine ammonium salt can also be used for the synthesis of phosphoramidites for oligonucleotide synthesis.Formula:C20H26N7O10P·NH3Purity:Min. 95%Molecular weight:572.47 g/mol

