CAS 61854-36-2

Demethoxycapillarisin

Description:

Demethoxycapillarisin is a chemical compound classified as a flavonoid, specifically a type of natural product derived from various plants, particularly those in the Asteraceae family. It is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and anticancer activities. The compound exhibits a complex structure characterized by multiple aromatic rings and hydroxyl groups, which contribute to its biological activity. Demethoxycapillarisin has garnered interest in medicinal chemistry due to its ability to modulate various cellular pathways, making it a candidate for further research in therapeutic applications. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in experimental settings. As with many flavonoids, its effects may be influenced by the presence of other compounds in herbal extracts, highlighting the importance of studying it in the context of whole plant materials. Overall, demethoxycapillarisin represents a promising area of study within natural product chemistry and pharmacology.

Formula: C₁₅H₁₀O₆

InChI: InChI=1S/C15H10O6/c16-8-1-3-10(4-2-8)20-14-7-12(19)15-11(18)5-9(17)6-13(15)21-14/h1-7,16-18H

InChI key: InChIKey=UBSCDKPKWHYZNX-UHFFFAOYSA-N

SMILES: O=C1C=2C(OC(OC3=CC=C(O)C=C3)=C1)=CC(O)=CC2O

Synonyms:

• 4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-(4-hydroxyphenoxy)-
• Demethoxycapillarisin
• 6-Demethoxycapillarisin
• 5,7-Dihydroxy-2-(4-hydroxyphenoxy)-4H-1-benzopyran-4-one

Demethoxycapillarisin

CAS: 61854-36-2

Formula: C₁₅H₁₀O₆

Purity: 97.5%

Color and Shape: Solid

Molecular weight: 286.2363

Ref: IN-DA00EGU8

Demethoxycapillarisin

CAS: 61854-36-2

Formula: C₁₅H₁₀O₆

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 286.239

Ref: BP-SBP02358

Demethoxycapillarisin

CAS: 61854-36-2

Demethoxycapillarisin is a natural product for research related to life sciences. The catalog number is TN3819 and the CAS number is 61854-36-2.

Formula: C₁₅H₁₀O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 286.239

Ref: TM-TN3819

Demethoxycapillarisin

CAS: 61854-36-2

Demethoxycapillarisin is a natural phenolic compound, which is primarily derived from plants in the Artemisia genus. This compound exhibits significant biological activity, acting as an antioxidant and anti-inflammatory agent by modulating oxidative stress and inflammatory pathways. Its mode of action involves the scavenging of free radicals and the inhibition of pro-inflammatory mediators at the cellular level.

Formula: C₁₅H₁₀O₆

Purity: Min. 95%

Molecular weight: 286.24 g/mol

Ref: 3D-LCA85436