CymitQuimica logo

CAS 61858-38-6

:

Ethanone, 2-bromo-1-(3-iodophenyl)-

Description:
Ethanone, 2-bromo-1-(3-iodophenyl)-, also known by its CAS number 61858-38-6, is an organic compound characterized by its functional groups and molecular structure. It features a ketone functional group (ethanone) and is substituted with a bromine atom and a 3-iodophenyl group, which contributes to its reactivity and potential applications in organic synthesis. The presence of halogens, such as bromine and iodine, typically enhances the compound's electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is likely to be a solid at room temperature, with a specific melting point and solubility characteristics influenced by its halogen substituents. Its unique structure may also impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, this compound exemplifies the complexity and utility of halogenated organic molecules in chemical research and industry.
Formula:C8H6BrIO
InChI:InChI=1S/C8H6BrIO/c9-5-8(11)6-2-1-3-7(10)4-6/h1-4H,5H2
InChI key:LZXVONZDKAPXSO-UHFFFAOYSA-N
SMILES:C1=CC(=CC(=C1)I)C(=O)CBr
Found 4 products.