CAS 6186-22-7
:4-Bromophenylacetonate
Description:
4-Bromophenylacetonate, with the CAS number 6186-22-7, is an organic compound characterized by the presence of a bromine atom attached to a phenyl group, which is further connected to an acetonate moiety. This compound typically exhibits a white to light yellow crystalline appearance. It is known for its role in organic synthesis, particularly in the formation of various derivatives and intermediates. The bromine substituent enhances its reactivity, making it useful in electrophilic aromatic substitution reactions. Additionally, 4-Bromophenylacetonate may exhibit moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water due to its hydrophobic phenyl group. Its chemical properties include the ability to undergo nucleophilic substitution and participate in various coupling reactions, which are valuable in the synthesis of pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled, and appropriate personal protective equipment should be used.
Formula:C24H24N2O5S
InChI:InChI=1/C24H24N2O5S/c1-17-13-18(2)15-19(14-17)26(32(29,30)20-9-5-4-6-10-20)16-23(27)25-22-12-8-7-11-21(22)24(28)31-3/h4-15H,16H2,1-3H3,(H,25,27)
SMILES:Cc1cc(C)cc(c1)N(CC(=Nc1ccccc1C(=O)OC)O)S(=O)(=O)c1ccccc1
Synonyms:- 4-Bromophenylacetone
- 1-(4-Bromophenyl)Propan-2-One
- methyl 2-{[N-(3,5-dimethylphenyl)-N-(phenylsulfonyl)glycyl]amino}benzoate
- 1-(4-Bromo-phenyl)-propan-2-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Bromophenylacetone, 98%
CAS:4-Bromophenylacetone is used to prepare biphenyl-4-yl-acetone by reacting with phenylboronic acid using cesium fluoride as a reagent and palladium phosphine complex as a catalyst. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentati
Formula:C24H24N2O5SPurity:98%Color and Shape:Liquid, Clear pale yellow to yellowMolecular weight:452.534-Bromophenylacetone
CAS:Formula:C9H9BrOPurity:>98.0%(GC)Color and Shape:Light orange to Yellow to Green clear liquidMolecular weight:213.07(4-Bromophenyl)acetone
CAS:Controlled Product4-Bromophenylacetone is a useful building block that is used in the synthesis of fine chemicals, research chemicals, and specialty chemicals. This compound can be used as a reagent or as a speciality chemical and has been shown to be highly reactive. 4-Bromophenylacetone is also a versatile building block with many possible reactions. It has also been shown to be an intermediate for the synthesis of pharmaceuticals and agrochemicals. CAS No. 6186-22-7Formula:C9H9BrOPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:213.07 g/mol



