CAS 61864-82-2
:N-formyl-nle-leu-phe
Description:
N-formyl-nle-leu-phe, with the CAS number 61864-82-2, is a synthetic peptide that is characterized by its specific amino acid sequence, which includes N-formylation of the amino acid nleucine (Nle) followed by leucine (Leu) and phenylalanine (Phe). This compound is typically used in biochemical research and has applications in the study of peptide interactions and biological activity. The N-formyl group can influence the peptide's stability and its interaction with biological receptors. Peptides like N-formyl-nle-leu-phe may exhibit various biological activities, including antimicrobial properties or roles in immune response modulation. The structural characteristics, such as the presence of hydrophobic side chains from leucine and phenylalanine, contribute to its overall conformation and potential biological function. As with many peptides, its solubility, stability, and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C22H33N3O5
InChI:InChI=1/C22H33N3O5/c1-4-5-11-17(23-14-26)20(27)24-18(12-15(2)3)21(28)25-19(22(29)30)13-16-9-7-6-8-10-16/h6-10,14-15,17-19H,4-5,11-13H2,1-3H3,(H,23,26)(H,24,27)(H,25,28)(H,29,30)/t17-,18-,19-/m0/s1
SMILES:CCCC[C@@H](C(=N[C@@H](CC(C)C)C(=N[C@@H](Cc1ccccc1)C(=O)O)O)O)N=CO
Synonyms:- N-Formylnorleucyl-leucyl-4-phenylalanine
- Fnllp
- N-Fnlp
- N-Formyl-nle-leu-p-phe
- N-Formyl-norleucyl-leucyl-p-phenylalanine
- L-Phenylalanine, N-(N-(N-formyl-L-norleucyl)-L-leucyl)-
- L-Phenylalanine, N-formyl-L-norleucyl-L-leucyl-
- N-formyl-L-norleucyl-L-leucyl-L-phenylalanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
For-Nle-Leu-Phe-OH
CAS:<p>Nle-Leu-Phe-OH is a potent colony-stimulating factor that binds to the receptor on the surface of cells and stimulates the production of white blood cells. Nle-Leu-Phe-OH has been shown to induce actin filament formation, which is necessary for cell movement. It also induces cytosolic calcium release and enhances protein synthesis. Nle-Leu-Phe-OH also binds to phosphatase and inhibits its activity, which may be due to a conformational change in the enzyme. This process is necessary for the synthesis of DNA and other proteins from amino acids. Nle-Leu-Phe-OH also causes an increase in the uptake of Ca2+ ions by cells.</p>Formula:C22H33N3O5Purity:Min. 95%Molecular weight:419.51 g/mol
