CAS 61874-13-3

2,6-Diethyl-N-(2-propoxyethyl)aniline

Description:

2,6-Diethyl-N-(2-propoxyethyl)aniline is an organic compound characterized by its aniline structure, which features an amino group (-NH2) attached to a benzene ring. The compound has two ethyl groups at the 2 and 6 positions of the benzene ring, contributing to its hydrophobic characteristics. The presence of the propoxyethyl substituent at the nitrogen atom enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. This compound is typically used in various chemical applications, including as an intermediate in the synthesis of dyes, pharmaceuticals, and agrochemicals. Its molecular structure suggests potential for hydrogen bonding due to the amino group, which may affect its physical properties such as boiling point and melting point. Additionally, the compound's stability and reactivity can be influenced by the steric hindrance introduced by the ethyl groups. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₁₅H₂₅NO

InChI: InChI=1/C15H25NO/c1-4-11-17-12-10-16-15-13(5-2)8-7-9-14(15)6-3/h7-9,16H,4-6,10-12H2,1-3H3

SMILES: CCCOCCNc1c(CC)cccc1CC

Synonyms:

• 2,6-Diethyl-N-(2-propoxyethyl)-benzenamine