CAS 61875-40-9
:2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-carbonitrile
Description:
2,3-Dioxo-1,2,3,4-tetrahydroquinoxaline-6-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a quinoxaline core. This compound features two carbonyl groups (dioxo) and a cyano group (carbonitrile) that contribute to its reactivity and potential applications in various fields, including medicinal chemistry and materials science. The presence of the dioxo and cyano functionalities suggests that it may exhibit interesting biological activities, potentially serving as a scaffold for drug development. Its tetrahydroquinoxaline structure indicates that it is a saturated derivative, which can influence its solubility and stability. Additionally, the compound's molecular structure may allow for various substitution patterns, leading to derivatives with tailored properties. As with many heterocycles, it may participate in diverse chemical reactions, including nucleophilic additions and cycloadditions, making it a valuable compound for synthetic organic chemistry. Overall, 2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-carbonitrile is a compound of interest due to its structural features and potential applications.
Formula:C9H5N3O2
InChI:InChI=1/C9H5N3O2/c10-4-5-1-2-6-7(3-5)12-9(14)8(13)11-6/h1-3H,(H,11,13)(H,12,14)
SMILES:c1cc2c(cc1C#N)[nH]c(=O)c(=O)[nH]2
Synonyms:- 2,3-Dihydroxyquinoxaline-6-Carbonitrile
- 6-Quinoxalinecarbonitrile, 2,3-Dihydroxy-
- 2,3-DIOXO-1,2,3,4-TETRAHYDROQUINOXALINE-6-CARBONITRILE
- 6-Cyano-2,3-dihydroxyquinoxaline
- 6-Quinoxalinecarbonitrile,1,2,3,4-tetrahydro-2,3-dioxo-(9CI)
- 2,3-Dioxo-2,3-dihydroquinoxaline-6-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,3-Dioxo-1,2,3,4-tetrahydroquinoxaline-6-carbonitrile
CAS:Formula:C9H5N3O2Color and Shape:SolidMolecular weight:187.1549

