CAS 6188-25-6
:6-chloro-H-imidazo[1,2-a]pyridine
Description:
6-Chloro-H-imidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 6-position of the imidazo ring enhances its reactivity and solubility in various solvents. This compound typically exhibits a pale yellow to brownish appearance and is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in biological systems. Additionally, the compound may participate in electrophilic substitution reactions due to the electron-withdrawing nature of the chlorine substituent. As with many heterocycles, it may also exhibit fluorescence properties, which can be useful in analytical applications. Overall, 6-chloro-H-imidazo[1,2-a]pyridine is a versatile compound with significant implications in research and pharmaceutical applications.
Formula:C7H5ClN2
InChI:InChI=1/C7H5ClN2/c8-6-1-2-7-9-3-4-10(7)5-6/h1-5H
SMILES:c1cc2nccn2cc1Cl
Synonyms:- 6-Chloroimidazo[1,2-a]pyridine
- Imidazo[1,2-A]Pyridine, 6-Chloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-Chloroimidazo[1,2-a]pyridine
CAS:Formula:C7H5ClN2Purity:>98.0%(GC)(T)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:152.586-Chloroimidazo[1,2-a]pyridine, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H5ClN2Purity:97%Color and Shape:Cream, Crystals or powder or crystalline powderMolecular weight:152.586-chloroimidazo[1,2-a]pyridine
CAS:Formula:C7H5ClN2Purity:97%Color and Shape:SolidMolecular weight:152.58106-Chloroimidazo[1,2-a]pyridine
CAS:6-Chloroimidazo[1,2-a]pyridineFormula:C7H5ClN2Purity:≥95%Color and Shape: solidMolecular weight:152.58g/mol6-Chloroimidazo[1,2-a]pyridine
CAS:Formula:C7H5ClN2Purity:97%Color and Shape:Solid, CrystallineMolecular weight:152.58




