CymitQuimica logo

CAS 61888-37-7

:

5-(4-methylphenyl)cyclohexane-1,3-dione

Description:
5-(4-Methylphenyl)cyclohexane-1,3-dione, with the CAS number 61888-37-7, is an organic compound characterized by its cyclohexane ring structure substituted with a 4-methylphenyl group and two ketone functional groups at the 1 and 3 positions. This compound typically exhibits a solid state at room temperature and is likely to be a pale yellow to white crystalline substance. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic additions and condensation reactions, due to the presence of the diketone functionality. The compound's solubility is generally moderate in organic solvents, while its reactivity can be influenced by the electron-donating methyl group on the phenyl ring. Additionally, it may exhibit interesting properties such as fluorescence or UV absorption, depending on its specific electronic structure. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C13H14O2
InChI:InChI=1/C13H14O2/c1-9-2-4-10(5-3-9)11-6-12(14)8-13(15)7-11/h2-5,11H,6-8H2,1H3
InChI key:NFJVIBUOAMVFME-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)C1CC(=O)CC(=O)C1
Found 4 products.