CAS 619-12-5
:4-Formyl-3-hydroxybenzoic acid
Description:
4-Formyl-3-hydroxybenzoic acid, also known as salicylaldehyde-4-carboxylic acid, is an organic compound characterized by its aromatic structure featuring both an aldehyde and a carboxylic acid functional group. Its molecular formula is C8H6O3, indicating the presence of eight carbon atoms, six hydrogen atoms, and three oxygen atoms. This compound typically appears as a white to pale yellow crystalline solid and is soluble in polar solvents such as water and alcohols due to the presence of the hydroxyl and carboxylic acid groups. It exhibits properties such as acidity, which is attributed to the carboxylic acid group, and reactivity typical of aldehydes, allowing it to participate in various chemical reactions, including condensation and oxidation. 4-Formyl-3-hydroxybenzoic acid is often used in organic synthesis and may serve as an intermediate in the production of dyes, pharmaceuticals, and other chemical compounds. Its unique structure also allows for potential applications in materials science and biochemistry.
Formula:C8H6O4
InChI:InChI=1S/C8H6O4/c9-4-6-2-1-5(8(11)12)3-7(6)10/h1-4,10H,(H,11,12)
InChI key:InChIKey=FDDHFCWYCKQKGY-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(O)=C(C=O)C=C1
Synonyms:- Benzoic Acid, 4-Formyl-3-Hydroxy-
- NSC 249767
- Terephthalaldehydic acid, 3-hydroxy-
- 4-Formyl-3-hydroxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Formyl-3-hydroxybenzoic acid
CAS:Formula:C8H6O4Purity:98%Color and Shape:SolidMolecular weight:166.13084-Formyl-3-hydroxybenzoic acid
CAS:4-Formyl-3-hydroxybenzoic acidPurity:95%Molecular weight:166.13g/mol4-Formyl-3-hydroxybenzoic acid
CAS:4-Formyl-3-hydroxybenzoic acid (4FHB) is a member of the phenylacetic acid family. It has been shown to have potential as a substrate for creatine kinase and amines, as well as an inhibitor of the enzyme. 4FHB binds to the surface of silica particles in order to enhance Raman scattering in a solid-phase synthesis. The molecular weight of 4FHB is 148 g/mol, with optical properties that can be described by fluorescence spectroscopy. 4FHB has been shown to be homochiral and tetradentate, with a magnetic resonance spectrum that can be characterized by hydroxyl group and salicylaldehyde groups.Formula:C8H6O4Purity:Min. 96.5 Area-%Color and Shape:PowderMolecular weight:166.13 g/mol4-Formyl-3-hydroxybenzoic acid
CAS:Formula:C8H6O4Purity:95%Color and Shape:Solid, CrystallineMolecular weight:166.132



