CAS 619-20-5

3-ethylbenzoic acid

Description:

3-Ethylbenzoic acid, with the CAS number 619-20-5, is an aromatic carboxylic acid characterized by the presence of a benzoic acid structure with an ethyl group attached to the meta position of the benzene ring. This compound typically appears as a white to off-white crystalline solid and has a melting point that varies depending on purity and environmental conditions. It is slightly soluble in water but more soluble in organic solvents such as ethanol and ether. The presence of the carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and acid-base reactions. 3-Ethylbenzoic acid can be used in organic synthesis and may serve as an intermediate in the production of dyes, pharmaceuticals, and other chemical compounds. Its structural characteristics contribute to its reactivity and potential applications in various fields, including materials science and medicinal chemistry.

Formula: C₉H₁₀O₂

InChI: InChI=1/C9H10O2/c1-2-7-4-3-5-8(6-7)9(10)11/h3-6H,2H2,1H3,(H,10,11)

SMILES: CCc1cccc(c1)C(=O)O

Synonyms:

• Benzoic Acid, 3-Ethyl-
• 3-Ethylbenzoic acid
• M-ETHYLBENZOIC ACID
• RARECHEM AL BO 1547
• Benzoic acid, 3-ethyl- (9CI)

3-Ethylbenzoic acid

CAS: 619-20-5

Formula: C₉H₁₀O₂

Purity: 99%

Color and Shape: Solid

Molecular weight: 150.1745

Ref: IN-DA00EADV

3-Ethylbenzoic acid

CAS: 619-20-5

3-Ethylbenzoic acid is an aromatic compound widely used in biochemical experiments and drug synthesis research.

Formula: C₉H₁₀O₂

Purity: 99.45%

Color and Shape: Solid

Molecular weight: 150.17

Ref: TM-TN9253

3-Ethylbenzoic acid

CAS: 619-20-5

3-Ethylbenzoic acid

Formula: C₉H₁₀O₂

Purity: 97%

Molecular weight: 150.17

Ref: 54-OR94989

3-Ethylbenzoic acid

CAS: 619-20-5

3-Ethylbenzoic acid

Formula: C₉H₁₀O₂

Purity: 99%

Molecular weight: 150.17

Ref: IN-DG86680

3-Ethylbenzoic acid

CAS: 619-20-5

Formula: C₉H₁₀O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 150.177

Ref: 10-F222858

c3-Ethylbenzoic acid

CAS: 619-20-5

C3-Ethylbenzoic acid is an organic compound that can be synthesized from the reactants ethyl bromide, propylene oxide, and acetic anhydride. The synthesis of C3-Ethylbenzoic acid is a stepwise process in which the starting materials are converted to intermediates and then reacted to form the desired product. The reaction mechanism involves bond cleavage, which generates a carboxylic acid group on one end of the molecule and a phenyl group on the other end. C3-Ethylbenzoic acid interacts with clausamine and isoprene during transport through cell membranes. This interaction may lead to increased permeability of cell membranes by c3-ethylbenzoic acid.

Formula: C₉H₁₀O₂

Purity: Min. 95%

Molecular weight: 150.17 g/mol

Ref: 3D-FE138984