
CAS 619-39-6
:2-Octyldecanoic acid
Description:
2-Octyldecanoic acid, with the CAS number 619-39-6, is a long-chain fatty acid characterized by its hydrophobic nature and a branched structure. It features a carboxylic acid functional group, which imparts acidic properties, while the long hydrocarbon chain contributes to its lipophilicity. This compound typically appears as a colorless to pale yellow liquid or solid, depending on temperature. Its molecular structure includes a total of 18 carbon atoms, with a branching point at the second carbon from the carboxyl end, which influences its physical properties and reactivity. 2-Octyldecanoic acid is known for its applications in various fields, including cosmetics, lubricants, and as a surfactant due to its ability to reduce surface tension. Additionally, it may exhibit antimicrobial properties, making it of interest in food preservation and pharmaceutical formulations. Its relatively low solubility in water and high boiling point are typical of long-chain fatty acids, which also contribute to its stability under various conditions.
Formula:C18H36O2
InChI:InChI=1S/C18H36O2/c1-3-5-7-9-11-13-15-17(18(19)20)16-14-12-10-8-6-4-2/h17H,3-16H2,1-2H3,(H,19,20)
InChI key:InChIKey=OYYXZGFIZTYYRB-UHFFFAOYSA-N
SMILES:C(CCCCCCCC)(CCCCCCCC)C(O)=O
Synonyms:- Decanoic acid, 2-octyl-
- 2-Octyldecanoic acid
- Dioctylacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Decanoic acid, 2-octyl-
CAS:Decanoic acid, 2-octyl- can be used for emulsifier or lubricant.Formula:C18H36O2Color and Shape:SolidMolecular weight:284.482-Octyldecanoic acid
CAS:2-Octyldecanoic acid is a fatty acid that is used as a stabilizer in detergent compositions. This stabilizer is also utilizable at high alkali metal concentrations, which makes it suitable for use in hard water conditions. 2-Octyldecanoic acid has a low viscosity at room temperature, and the nature of its hydrocarbon chain leads to increased stability against decomposition when heated or exposed to carbon tetrachloride. It can be synthesized from an aliphatic hydrocarbon, such as octane, to form a macrocyclic ring structure. 2-Octyldecanoic acid also has optical properties that depend on the configuration of the carbon atoms. The molecule has two chiral centers and can exist in four different forms: erythro (E), threo (T), dithreo (D) and meso (M). The optical activity of 2-octyldecanoic acid dependsFormula:C18H36O2Purity:Min. 95%Molecular weight:284.5 g/mol




