CAS 619-52-3
:(+)-p-Menth-3-ene
Description:
(+)-p-Menth-3-ene, with the CAS number 619-52-3, is a bicyclic monoterpene characterized by its unique structure and properties. It is a colorless to pale yellow liquid with a characteristic minty aroma, commonly found in essential oils, particularly those derived from mint plants. This compound exhibits a boiling point that typically falls within the range of common organic solvents, making it relatively volatile. Its molecular formula is C10H16, and it features a double bond in its cyclohexane ring, contributing to its reactivity and potential as a building block in organic synthesis. (+)-p-Menth-3-ene is known for its applications in the fragrance and flavor industry, as well as in the production of various chemical intermediates. Additionally, it may possess biological activities, including antimicrobial properties, although further research is often required to fully understand its potential health effects. Overall, (+)-p-Menth-3-ene is a significant compound in both natural products chemistry and industrial applications.
Formula:C10H18
InChI:InChI=1S/C10H18/c1-8(2)10-6-4-9(3)5-7-10/h6,8-9H,4-5,7H2,1-3H3/t9-/m0/s1
InChI key:InChIKey=YYCPSEFQLGXPCO-VIFPVBQESA-N
SMILES:C(C)(C)C=1CC[C@@H](C)CC1
Synonyms:- (4R)-4-Methyl-1-(1-methylethyl)cyclohexene
- Cyclohexene, 4-methyl-1-(1-methylethyl)-, (4R)-
- Cyclohexene, 4-methyl-1-(1-methylethyl)-, (R)-
- (+)-3-Menthene
- p-Menth-3-ene, (R)-(+)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
