CAS 619-64-7
:4-Ethylbenzoic acid
Description:
4-Ethylbenzoic acid, with the CAS number 619-64-7, is an aromatic carboxylic acid characterized by the presence of an ethyl group attached to the para position of a benzoic acid structure. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents such as ethanol and ether, but has limited solubility in water due to its hydrophobic ethyl group. It has a melting point that generally falls within a moderate range, indicative of its crystalline nature. The presence of the carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and acid-base reactions. 4-Ethylbenzoic acid is utilized in organic synthesis and can serve as an intermediate in the production of dyes, pharmaceuticals, and other chemical compounds. Its structural features contribute to its reactivity and potential applications in various fields, including materials science and medicinal chemistry.
Formula:C9H10O2
InChI:InChI=1S/C9H10O2/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6H,2H2,1H3,(H,10,11)
InChI key:InChIKey=ZQVKTHRQIXSMGY-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(CC)C=C1
Synonyms:- 4-Ethyl Benzoic acid
- 4-Ethylbenzoate
- Benzoic Acid, 4-Ethyl-
- Benzoic acid, p-ethyl-
- NSC 59888
- P-Ethylbenzoic acid
- 4-Ethylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Ethylbenzoic Acid
CAS:Formula:C9H10O2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:150.184-Ethylbenzoic acid, 99%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H10O2Purity:99%Color and Shape:White to pale yellow or cream, Crystalline powderMolecular weight:150.18Ref: IN-DA00340R
10g21.00€1kg109.00€25g24.00€100g25.00€10kgTo inquire25kgTo inquire500g68.00€50kgTo inquire4-Ethylbenzoic acid
CAS:4-Ethylbenzoic acidFormula:C9H10O2Purity:≥95%Color and Shape: off white crystalline solidMolecular weight:150.17g/mol4-Ethylbenzoic acid
CAS:<p>4-Ethylbenzoic acid is a fatty acid that can be found in human and animal cells. It is an important intermediate for the synthesis of phenolic acids and it has been shown to have physiological effects on yeast. 4-Ethylbenzoic acid binds to bacterial enzymes, such as acylation reactions, which are involved in energy production. This binding prevents the enzyme from completing its reaction and leads to a decrease in energy production. Acylation reactions are also used by bacteria to produce biofilms, which can lead to chronic infections. The redox potential of 4-ethylbenzoic acid makes it suitable for wastewater treatment because it reacts with hydroxyl ions and reduces their concentration, causing wastewater to become less toxic. The second order rate constant of 4-ethylbenzoic acid was measured using magnetic resonance spectroscopy and structural analysis techniques.</p>Formula:C9H10O2Purity:Min. 95%Color and Shape:PowderMolecular weight:150.17 g/mol4-Ethylbenzoic acid
CAS:Controlled Product<p>Applications 4-Ethylbenzoic acid<br></p>Formula:C9H10O2Color and Shape:NeatMolecular weight:150.18






