CAS 619-75-0
:1-(Dibromomethyl)-4-nitrobenzene
Description:
1-(Dibromomethyl)-4-nitrobenzene, with the CAS number 619-75-0, is an organic compound characterized by its aromatic structure, featuring a nitro group and dibromomethyl substituents. This compound typically appears as a yellow to brown solid and is known for its moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water. The presence of the nitro group contributes to its electron-withdrawing properties, influencing its reactivity and making it a useful intermediate in organic synthesis, particularly in the production of dyes and pharmaceuticals. Additionally, the dibromomethyl group enhances its potential for further chemical modifications, allowing for various substitution reactions. Safety considerations are important, as compounds containing bromine and nitro groups can pose health risks, necessitating proper handling and storage protocols. Overall, 1-(Dibromomethyl)-4-nitrobenzene is a valuable compound in synthetic organic chemistry, with applications that leverage its unique chemical properties.
Formula:C7H5Br2NO2
InChI:InChI=1S/C7H5Br2NO2/c8-7(9)5-1-3-6(4-2-5)10(11)12/h1-4,7H
InChI key:InChIKey=MKHFRSNFHCJQIQ-UHFFFAOYSA-N
SMILES:C(Br)(Br)C1=CC=C(N(=O)=O)C=C1
Synonyms:- 1-(Dibromomethyl)-4-Nitrobenzene
- 4-Nitrobenzylidene Bromide
- Benzene, 1-(dibromomethyl)-4-nitro-
- NSC 5503
- Toluene, α,α-dibromo-p-nitro-
- p-Nitrobenzal bromide
- p-Nitrobenzylidene bromide
- α,α-Dibromo-p-nitrotoluene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-(Dibromomethyl)-4-nitrobenzene
CAS:1-(Dibromomethyl)-4-nitrobenzenePurity:98%Molecular weight:294.93g/mol1-(dibromomethyl)-4-nitrobenzene
CAS:Formula:C7H5Br2NO2Purity:98%Color and Shape:SolidMolecular weight:294.931-(Dibromomethyl)-4-nitrobenzene
CAS:Controlled ProductFormula:C7H5Br2NO2Color and Shape:NeatMolecular weight:294.9281-(Dibromomethyl)-4-nitrobenzene
CAS:1-(Dibromomethyl)-4-nitrobenzene is a chemical substance that belongs to the group of industrial chemicals. It has been classified as toxic and hazardous for human health, with an expansion potential. This substance is used in the production of a number of insecticides and other chemical control agents. The toxic effects of 1-(dibromomethyl)-4-nitrobenzene are related to its alkaline properties and include irritation of the eyes, skin, and respiratory tract; central nervous system depression; liver damage; kidney damage; and gastrointestinal disturbances. Inhalation may result in pulmonary edema or death due to oxygen deprivation. This chemical is also known to cause cancer in animals.Formula:C7H5Br2NO2Purity:Min. 95%Molecular weight:294.93 g/mol



