CAS 619-89-6
:4-Nitrocinnamic acid
Description:
4-Nitrocinnamic acid is an organic compound characterized by its aromatic structure, featuring a nitro group (-NO2) and a carboxylic acid group (-COOH) attached to a cinnamic acid backbone. It typically appears as a yellow crystalline solid and is known for its role in various chemical reactions and applications, including as a precursor in organic synthesis and in the development of materials with photonic properties. The presence of the nitro group enhances its reactivity, making it useful in the synthesis of dyes and pharmaceuticals. 4-Nitrocinnamic acid exhibits moderate solubility in organic solvents and limited solubility in water, which is common for compounds with large aromatic systems. Its melting point and boiling point can vary based on purity and environmental conditions. Additionally, it can undergo various chemical transformations, such as reduction and esterification, making it a versatile compound in organic chemistry. Safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C9H7NO4
InChI:InChI=1S/C9H7NO4/c11-9(12)6-3-7-1-4-8(5-2-7)10(13)14/h1-6H,(H,11,12)
InChI key:InChIKey=XMMRNCHTDONGRJ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC=C(C=CC(O)=O)C=C1
Synonyms:- (2E)-3-(4-Nitrophenyl)-2-propenoic acid
- (2E)-3-(4-nitrophenyl)prop-2-enoate
- (2E)-3-(4-nitrophenyl)prop-2-enoic acid
- (2Z)-3-(4-nitrophenyl)prop-2-enoic acid
- 2-Propenoic acid, 3-(4-nitrophenyl)-
- 3-(4-Nitrophenyl)-2-propenoic acid
- 3-(4-Nitrophenyl)Prop-2-Enoic Acid
- 3-(4-Nitrophenyl)acrylic acid
- 3-(4-Nitrophenyl)propenoic acid
- 4-Nitrocinnamic acid
- 4-Nitrocinnamic acid,predominantly trans
- Cinnamic acid, p-nitro-
- NSC 2067
- NSC 638142
- Trans-3-(3-Nitrophenyl)Propenoic Acid
- Trans-3-Nitrocinnamic Acid
- See more synonyms
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4-Nitrocinnamic Acid
CAS:Formula:C9H7NO4Purity:>99.0%(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:193.164-Nitrocinnamic acid
CAS:4-Nitrocinnamic acid is a cinnamic acid derivative used in synthesis.Formula:C9H7NO4Purity:99.27%Color and Shape:Yellow SolidMolecular weight:193.163-(4-Nitrophenyl)acrylic acid
CAS:Formula:C9H7NO4Purity:98%Color and Shape:SolidMolecular weight:193.15623-(4-Nitrophenyl)acrylic acid
CAS:Formula:C9H7NO4Purity:95Color and Shape:SolidMolecular weight:193.1584-Nitrocinnamic acid
CAS:3-(4-Nitrophenyl)acrylic acidFormula:C9H7NO4Purity:98% (E)Molecular weight:193.164-Nitrocinnamic acid
CAS:4-Nitrocinnamic acidFormula:C9H7NO4Purity:98%Color and Shape:Solid-PowderMolecular weight:193.156184-Nitrocinnamic Acid
CAS:Controlled ProductFormula:C9H7NO4Color and Shape:NeatMolecular weight:193.16






