CAS 61909-81-7
:Polyethylene glycol 12-hydroxystearate
Description:
Polyethylene glycol 12-hydroxystearate (PEG-12-hydroxystearate) is a non-ionic surfactant and emulsifying agent commonly used in cosmetic and pharmaceutical formulations. It is derived from the esterification of polyethylene glycol and hydroxystearic acid, which contributes to its amphiphilic properties, allowing it to interact with both hydrophilic and hydrophobic substances. This compound typically appears as a white to off-white solid or waxy substance and is known for its ability to stabilize emulsions, enhance the solubility of active ingredients, and improve the texture of formulations. PEG-12-hydroxystearate is often utilized in creams, lotions, and ointments due to its skin-conditioning properties and mildness, making it suitable for sensitive skin applications. Additionally, it is recognized for its low toxicity and is generally regarded as safe for use in personal care products. Its versatility and effectiveness in various formulations make it a valuable ingredient in the cosmetic and pharmaceutical industries.
Formula:(C2H4O)nC18H36O3
InChI:InChI=1/C20H40O4/c1-2-3-4-11-14-19(22)15-12-9-7-5-6-8-10-13-16-20(23)24-18-17-21/h19,21-22H,2-18H2,1H3
InChI key:InChIKey=JVKUCNQGESRUCL-UHFFFAOYSA-N
SMILES:CCCCCCC(CCCCCCCCCCC(=O)OCCO)O
Synonyms:- Hs 15
- Kolliphor HS 15
- Poly(oxy-1,2-ethanediyl), alpha-(12-hydroxy-1-oxooctadecyl)-omega-hydroxy-
- Poly(oxy-1,2-ethanediyl), α-(12-hydroxy-1-oxooctadecyl)-ω-hydroxy-
- Polyethylene glycol 12-hydroxystearate
- Solutol H 15
- Solutol HR
- Solutol HS
- Solutol HS 15
- Solutol SH 15
- T 46155
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Polyethylene glycol 12-hydroxystearate
CAS:Polyethylene glycol 12-hydroxystearatePurity:≥98%Molecular weight:344.536g/molPolyethylene glycol 12-hydroxystearate
CAS:Polyethylene glycol 12-hydroxystearate (Solutol HS-15) is a permeability enhancer.Formula:C20H40O4Purity:98% - mixtureColor and Shape:SolidMolecular weight:344.536Polyethylene glycol 12-hydroxystearate
CAS:<p>Polyethylene glycol 12-hydroxystearate is a non-ionic surfactant derived from the esterification of 12-hydroxystearic acid, typically sourced from castor oil, with polyethylene glycol. This compound exhibits amphiphilic properties, allowing it to reduce surface and interfacial tension between different phases. Its mode of action primarily involves facilitating the formation of stable emulsions by reducing the energy required to disperse one phase uniformly within another.</p>Formula:C20H40O4Purity:Min. 95%Molecular weight:344.5 g/mol




