CAS 61914-47-4
:(1R,3S)-3-(2,2-Dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl chloride
Description:
(1R,3S)-3-(2,2-Dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl chloride, with CAS number 61914-47-4, is a chemical compound characterized by its unique cyclopropane structure and the presence of a carbonyl chloride functional group. This compound features a dichloroethenyl substituent, which contributes to its reactivity and potential applications in organic synthesis. The stereochemistry indicated by the (1R,3S) configuration suggests specific spatial arrangements of its atoms, which can influence its chemical behavior and interactions. As a carbonyl chloride, it is likely to be reactive, particularly with nucleophiles, making it useful in various chemical reactions, including acylation processes. The presence of the dimethyl groups on the cyclopropane ring may also impart steric hindrance, affecting its reactivity and stability. Overall, this compound's distinctive structure and functional groups make it of interest in synthetic organic chemistry and potentially in agrochemical applications. However, safety precautions should be observed due to the presence of chlorine atoms, which can pose health and environmental risks.
Formula:C8H9Cl3O
InChI:InChI=1S/C8H9Cl3O/c1-8(2)4(3-5(9)10)6(8)7(11)12/h3-4,6H,1-2H3/t4-,6+/m1/s1
InChI key:InChIKey=CHLAOFANYRDCPD-XINAWCOVSA-N
SMILES:C(Cl)(=O)[C@@H]1[C@@H](C=C(Cl)Cl)C1(C)C
Synonyms:- (1R)-trans-3-(2,2-Dichloro-1-ethenyl)-2,2-dimethylcyclopropanecarboxylate chloride
- (1R)-trans-3-(2,2-Dichloro-1-ethenyl)-2,2-dimethylcyclopropanecarboxylic acid chloride
- (1R)-trans-3-(2,2-Dichloro-1-ethenyl)-2,2-dimethylcyclopropanecarboxylic acid chloride salt
- (1R)-trans-3-(2,2-Dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl chloride
- (1R)-trans-Permethric acid chloride
- (1R)-trans-Permethroyl chloride
- (1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl chloride
- Cyclopropanecarbonyl chloride, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (1R,3S)-
- Cyclopropanecarbonyl chloride, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (1R-trans)-
- (1R)-trans-3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride
- (1R-trans)-3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(1R)-trans-Permethroyl Chloride
CAS:Controlled ProductApplications (1R)-trans-Permethroyl Chloride is an intermediate in the synthesis of (1R,3S)-3-(2,2-Dichloroethenyl)-2,2-dimethylcyclopropanecarboxamide (D437330), which is a useful research chemical compound.
Formula:C8H9Cl3OColor and Shape:NeatMolecular weight:227.516
