CAS 61921-39-9

4-bromotetraphene

Description:

4-Bromotetraphene is an organic compound characterized by its polycyclic aromatic structure, which consists of four fused benzene rings with a bromine substituent at the fourth position. This compound exhibits typical properties of polycyclic aromatic hydrocarbons, including high stability and a tendency to participate in π-π stacking interactions due to its planar structure. The presence of the bromine atom introduces both electronegative characteristics and potential for further chemical reactivity, such as electrophilic substitution or cross-coupling reactions. 4-Bromotetraphene is generally insoluble in water but may dissolve in organic solvents, making it useful in various applications, including organic electronics and materials science. Its photophysical properties, such as fluorescence and absorption spectra, can be influenced by the bromine substitution, which may affect its electronic properties. Overall, 4-bromotetraphene serves as an interesting compound for research in organic chemistry and materials development, particularly in the context of studying the effects of halogenation on aromatic systems.

Formula: C₁₈H₁₁Br

InChI: InChI=1/C18H11Br/c19-18-7-3-6-15-16(18)9-8-14-10-12-4-1-2-5-13(12)11-17(14)15/h1-11H

SMILES: c1ccc2cc3c(ccc4c3cccc4Br)cc2c1

Synonyms:

• 4-Bromobenz[A]Anthracene
• 4-Bromobenzo[a]anthracene

4-Bromobenz[a]anthracene

CAS: 61921-39-9

Formula: C₁₈H₁₁Br

Purity: >97.0%(GC)

Color and Shape: Light yellow to Yellow to Green powder to crystal

Molecular weight: 307.19

Ref: 3B-B5450

4-Bromobenzo[a]anthracene

CAS: 61921-39-9

Formula: C₁₈H₁₁Br

Purity: 95%

Color and Shape: Solid

Molecular weight: 307.1839

Ref: IN-DA00EIMS

4-Bromotetraphene

CAS: 61921-39-9

4-Bromotetraphene

Purity: 95%

Molecular weight: 307.18g/mol

Ref: 54-OR90448

4-Bromotetraphene

CAS: 61921-39-9

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 307.19000244140625

Ref: 10-F455052