CAS 61934-55-2
:4-(bromomethyl)furan-2(5H)-one
Description:
4-(Bromomethyl)furan-2(5H)-one, with the CAS number 61934-55-2, is a heterocyclic organic compound featuring a furan ring substituted with a bromomethyl group and a carbonyl functional group. This compound is characterized by its furan structure, which contributes to its aromatic properties and potential reactivity. The presence of the bromomethyl group enhances its electrophilic character, making it a useful intermediate in organic synthesis, particularly in the formation of various derivatives through nucleophilic substitution reactions. Additionally, the carbonyl group in the furan ring can participate in various chemical reactions, such as condensation and addition reactions. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity and structural features make it of interest in medicinal chemistry and materials science, where it can be utilized in the synthesis of biologically active compounds or functional materials. Safety precautions should be observed when handling this compound due to the presence of bromine, which can be hazardous.
Formula:C5H5BrO2
InChI:InChI=1/C5H5BrO2/c6-2-4-1-5(7)8-3-4/h1H,2-3H2
SMILES:C1=C(CBr)COC1=O
Synonyms:- 2(5H)-Furanone, 4-(bromomethyl)-
- 4-(Bromomethyl)-2(5H)-furanone
- 4-Bromomethyl-5H-furan-2-one
- 4-(Bromomethyl)furan-2(5H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(Bromomethyl)-5-hydrofuran-2-one
CAS:Formula:C5H5BrO2Purity:95%Color and Shape:LiquidMolecular weight:176.99604-(Bromomethyl)furan-2(5H)-one
CAS:4-(Bromomethyl)furan-2(5H)-oneFormula:C5H5BrO2Purity:≥95%Color and Shape: yellow liquidMolecular weight:177.00g/mol4-(Bromomethyl)-5-hydrofuran-2-one
CAS:Yuzurine is a natural product that has been shown to be a potent inhibitor of the enzyme methionine adenosyltransferase. This drug has been synthesized from 4-(bromomethyl)-5-hydrofuran-2-one and propargyl bromide in the presence of a rhodium catalyst. Yuzurine is an optically active compound, which means that it can exist as two different enantiomers. The enantioselective synthesis of yuzurine was achieved by using a chiral dieckmann condensation reaction with ruthenium as a catalyst.
Formula:C5H5BrO2Purity:Min. 95%Molecular weight:177 g/mol



