CAS 61941-63-7

[2-amino-3-(4-chlorobenzoyl)phenyl]acetic acid

Description:

[2-amino-3-(4-chlorobenzoyl)phenyl]acetic acid, with the CAS number 61941-63-7, is an organic compound characterized by its amino acid structure, which includes an amino group (-NH2) and a carboxylic acid group (-COOH). This compound features a phenyl ring substituted with a 4-chlorobenzoyl group, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. The chlorobenzoyl moiety enhances its lipophilicity, potentially influencing its biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its synthesis involves standard organic reactions, including amination and acylation processes. As with many amino acids and their derivatives, it may participate in peptide bond formation, contributing to protein synthesis. Proper handling and storage are essential, as with all chemical substances, to ensure safety and stability.

Formula: C₁₅H₁₂ClNO₃

InChI: InChI=1/C15H12ClNO3/c16-11-6-4-9(5-7-11)15(20)12-3-1-2-10(14(12)17)8-13(18)19/h1-7H,8,17H2,(H,18,19)

SMILES: c1cc(CC(=O)O)c(c(c1)C(=O)c1ccc(cc1)Cl)N

Synonyms:

• 2-Amino-3-(4-Chlorobenzoyl)-Benzeneacetic Acid

AHR-6293

CAS: 61941-63-7

AHR-6293 is used to distinguishing the effect of anti-platelet aggregating drug properties and the effect of anti-inflammatory properties.

Formula: C₁₅H₁₂ClNO₃

Color and Shape: Solid

Molecular weight: 289.71

Ref: TM-T23684