CAS 61941-63-7
:[2-amino-3-(4-chlorobenzoyl)phenyl]acetic acid
Description:
[2-amino-3-(4-chlorobenzoyl)phenyl]acetic acid, with the CAS number 61941-63-7, is an organic compound characterized by its amino acid structure, which includes an amino group (-NH2) and a carboxylic acid group (-COOH). This compound features a phenyl ring substituted with a 4-chlorobenzoyl group, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. The chlorobenzoyl moiety enhances its lipophilicity, potentially influencing its biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its synthesis involves standard organic reactions, including amination and acylation processes. As with many amino acids and their derivatives, it may participate in peptide bond formation, contributing to protein synthesis. Proper handling and storage are essential, as with all chemical substances, to ensure safety and stability.
Formula:C15H12ClNO3
InChI:InChI=1/C15H12ClNO3/c16-11-6-4-9(5-7-11)15(20)12-3-1-2-10(14(12)17)8-13(18)19/h1-7H,8,17H2,(H,18,19)
SMILES:c1cc(CC(=O)O)c(c(c1)C(=O)c1ccc(cc1)Cl)N
Synonyms:- 2-Amino-3-(4-Chlorobenzoyl)-Benzeneacetic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
AHR-6293
CAS:AHR-6293 is used to distinguishing the effect of anti-platelet aggregating drug properties and the effect of anti-inflammatory properties.Formula:C15H12ClNO3Color and Shape:SolidMolecular weight:289.71
