CAS 6195-37-5
:N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(2,4-dichlorophenoxy)acetamide
Description:
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(2,4-dichlorophenoxy)acetamide, with the CAS number 6195-37-5, is a synthetic organic compound primarily used in agricultural applications, particularly as a herbicide. This compound features a complex molecular structure characterized by the presence of multiple halogen substituents, including chlorine and fluorine, which contribute to its biological activity and stability. The trifluoromethyl group enhances lipophilicity, allowing for better penetration into plant tissues. The dichlorophenoxy moiety is known for its role in herbicidal activity, often interfering with plant growth processes. The compound is typically solid at room temperature and exhibits moderate solubility in organic solvents. Its mode of action generally involves the disruption of specific biochemical pathways in target plants, leading to their inhibition or death. Safety and environmental impact assessments are crucial for its use, as with many agrochemicals, to mitigate potential risks to non-target organisms and ecosystems. Proper handling and application guidelines are essential to ensure efficacy while minimizing adverse effects.
Formula:C15H9Cl3F3NO2
InChI:InChI=1/C15H9Cl3F3NO2/c16-9-2-4-13(11(18)6-9)24-7-14(23)22-12-5-8(15(19,20)21)1-3-10(12)17/h1-6H,7H2,(H,22,23)
SMILES:c1cc(c(cc1C(F)(F)F)N=C(COc1ccc(cc1Cl)Cl)O)Cl
Synonyms:- acetamide, N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(2,4-dichlorophenoxy)-
- N-[2-Chloro-5-(trifluoromethyl)phenyl]-2-(2,4-dichlorophenoxy)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
NSC 105204
CAS:NSC 105204 is a bioactive chemical.Formula:C15H9Cl3F3NO2Color and Shape:SolidMolecular weight:398.59
