CAS 6196-57-2
:3-Deoxy-D-fructose
Description:
3-Deoxy-D-fructose, also known as D-allulose, is a monosaccharide and a rare sugar that is structurally similar to fructose. It is characterized by the absence of a hydroxyl group at the C-3 position, which distinguishes it from its structural isomer, D-fructose. This modification imparts unique properties to 3-deoxy-D-fructose, including a lower caloric value, making it an attractive alternative sweetener. It is known for its sweet taste, which is approximately 70% as sweet as sucrose, and it does not significantly impact blood glucose levels, making it suitable for diabetic diets. Additionally, 3-deoxy-D-fructose exhibits potential health benefits, such as improving insulin sensitivity and reducing fat accumulation. It is soluble in water and can be used in various food and beverage applications. The compound is generally recognized as safe (GRAS) by food safety authorities, further enhancing its appeal in the food industry. Its unique characteristics and potential health benefits continue to be the subject of research and interest in nutritional science.
Formula:C6H12O5
InChI:InChI=1S/C6H12O5/c7-2-4(9)1-5(10)6(11)3-8/h5-8,10-11H,1-3H2/t5-,6+/m0/s1
InChI key:InChIKey=OXFWZSUJNURRMW-NTSWFWBYSA-N
SMILES:[C@H](CC(CO)=O)([C@@H](CO)O)O
Synonyms:- D-erythro-2-Hexulose, 3-deoxy-
- D-erythro-Hexulose, 3-deoxy-
- 3-Deoxy-D-fructose
- D-erythro-2-Hexulose, 3-deoxy- (9CI)
- 3-deoxyhexulose
- (4S,5R)-1,4,5,6-tetrahydroxyhexan-2-one
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Deoxy-D-fructose
CAS:3-Deoxy-D-fructose is a neutral sugar that is found in the human liver and has been shown to be metabolized by cells in the target tissue. 3-Deoxy-D-fructose is used as a marker for diabetic patients, as it is present in high quantities in their blood plasma. 3-Deoxy-D-fructose can be detected with liquid chromatography coupled with mass spectrometry (LC/MS) methods. It has been shown to induce necrotic cell death, which may be due to its ability to produce reactive oxygen species. 3-Deoxy-D-fructose also inhibits protein synthesis by inhibiting the activity of polymerase chain reaction and hydroxylation reactions.
Formula:C6H12O5Purity:Min. 95%Color and Shape:Off-White Beige PowderMolecular weight:164.16 g/mol3-Deoxy-D-fructose-13C6
CAS:Controlled ProductFormula:C6H12O5Color and Shape:NeatMolecular weight:170.112




