CAS 61964-08-7

1,3-Dihydroisobenzofuran-5-ylamine

Description:

1,3-Dihydroisobenzofuran-5-ylamine, with the CAS number 61964-08-7, is an organic compound characterized by its unique bicyclic structure, which consists of a fused isobenzofuran and an amine group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the amine functional group imparts basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Additionally, the bicyclic structure contributes to its stability and reactivity profile. Safety data indicates that, like many amines, it should be handled with care due to potential irritant properties. Overall, 1,3-Dihydroisobenzofuran-5-ylamine is a compound of interest in both research and industrial applications, particularly in the development of new chemical entities.

Formula: C₁₄H₈N₂

InChI: InChI=1/C14H8N2/c15-9-13-7-6-12(8-14(13)10-16)11-4-2-1-3-5-11/h1-8H

SMILES: c1ccc(cc1)c1ccc(C#N)c(c1)C#N

Synonyms:

• 1,3-Dihydro-2-benzofuran-5-amine
• Biphenyl-3,4-Dicarbonitrile
• 1,3-dihydro-5-Isobenzofuranamine

1,3-Dihydroisobenzofuran-5-ylamine

CAS: 61964-08-7

Formula: C₈H₉NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 135.1632

Ref: IN-DA00ECR9

5-Amino-1,3-dihydrobenzo[c]furan

CAS: 61964-08-7

5-Amino-1,3-dihydrobenzo[c]furan

Purity: 99%

Color and Shape: Tan Powder

Molecular weight: 135.16g/mol

Ref: 54-OR16559

1,3-Dihydroisobenzofuran-5-amine

CAS: 61964-08-7

Formula: C₈H₉NO

Purity: 95%

Color and Shape: Light brown powder

Molecular weight: 135.166

Ref: 10-F214886