CAS 6197-39-3: methyl 1,2,5,6-tetrahydropyridine-3-carboxylate hydrochloride (1:1)
Description:Methyl 1,2,5,6-tetrahydropyridine-3-carboxylate hydrochloride (1:1), with the CAS number 6197-39-3, is a chemical compound characterized by its tetrahydropyridine structure, which includes a carboxylate functional group and a methyl ester. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. The hydrochloride form indicates that it is a salt, which often enhances its stability and solubility compared to its free base form. Methyl 1,2,5,6-tetrahydropyridine-3-carboxylate hydrochloride is of interest in medicinal chemistry and may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C7H12ClNO2
InChI:InChI=1/C7H11NO2.ClH/c1-10-7(9)6-3-2-4-8-5-6;/h3,8H,2,4-5H2,1H3;1H
