CAS 61977-29-5

6-chlorobenzo[d]isoxazol-3-ol

Description:

6-Chlorobenzo[d]isoxazol-3-ol is a chemical compound characterized by its unique structure, which includes a chlorinated benzene ring fused to an isoxazole moiety. The presence of the chlorine atom at the 6-position of the benzene ring contributes to its reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many halogenated aromatic compounds. The hydroxyl group at the 3-position enhances its potential for hydrogen bonding, influencing its interactions in various chemical environments. 6-Chlorobenzo[d]isoxazol-3-ol may be of interest in medicinal chemistry due to its structural features that could lead to pharmacological activity. Additionally, it may serve as an intermediate in organic synthesis or as a building block for more complex molecules. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental concerns.

Formula: C₇H₄ClNO₂

InChI: InChI=1/C7H4ClNO2/c8-4-1-2-5-6(3-4)11-9-7(5)10/h1-3H,(H,9,10)

SMILES: c1cc2c(cc1Cl)onc2O

Synonyms:

• 6-Chloro-3-hydroxy-1,2-benzisoxazole
• 6-chloro-1,2-benzisoxazol-3(2H)-one

6-Chlorobenzo[D]isoxazol-3-ol

CAS: 61977-29-5

Formula: C₇H₄ClNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 169.5652

Ref: IN-DA00EB8Z

6-Chloro-3-hydroxy-1,2-benzisoxazole

CAS: 61977-29-5

6-Chloro-3-hydroxy-1,2-benzisoxazole

Formula: C₇H₄ClNO₂

Purity: 95%

Color and Shape: off-white crystalline needles

Molecular weight: 169.57g/mol

Ref: 54-OR27159

6-Chloro-1,2-benzisoxazol-3-ol

CAS: 61977-29-5

Formula: C₇H₄ClNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 169.56

Ref: 10-F067549

6-Chloro-1,2-benzisoxazol-3(2H)-one

Controlled Product

CAS: 61977-29-5

Formula: C₇H₄ClNO₂

Color and Shape: Neat

Molecular weight: 169.565

Ref: TR-C364630