CymitQuimica logo

CAS 61977-85-3

:

N-benzylpentan-3-amine

Description:
N-benzylpentan-3-amine, with the CAS number 61977-85-3, is an organic compound characterized by its amine functional group and a benzyl substituent. It features a pentane backbone with an amine group located at the third carbon, which contributes to its basicity and potential reactivity. The presence of the benzyl group enhances its lipophilicity, making it more soluble in organic solvents compared to water. This compound may exhibit properties typical of amines, such as the ability to form hydrogen bonds, which can influence its boiling point and solubility. N-benzylpentan-3-amine may also participate in various chemical reactions, including alkylation and acylation, due to the nucleophilic nature of the amine group. Its structural characteristics suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any risks associated with its use.
Formula:C12H19N
InChI:InChI=1/C12H19N/c1-3-12(4-2)13-10-11-8-6-5-7-9-11/h5-9,12-13H,3-4,10H2,1-2H3
SMILES:CCC(CC)NCc1ccccc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.