CymitQuimica logo

CAS 61996-32-5

:

N-(5-methyl-1,3-thiazol-2-yl)acetamide

Description:
N-(5-methyl-1,3-thiazol-2-yl)acetamide is an organic compound characterized by its thiazole ring, which contributes to its biological activity and potential applications in pharmaceuticals. The thiazole moiety is a five-membered heterocyclic ring containing both sulfur and nitrogen, which imparts unique chemical properties. This compound features an acetamide functional group, enhancing its solubility in polar solvents and influencing its reactivity. Typically, compounds like this may exhibit antimicrobial, antifungal, or anti-inflammatory properties, making them of interest in medicinal chemistry. The presence of the methyl group on the thiazole ring can affect the compound's steric and electronic properties, potentially influencing its interaction with biological targets. Additionally, the molecular structure suggests that it may participate in hydrogen bonding due to the amide group, which can further affect its biological activity and solubility. Overall, N-(5-methyl-1,3-thiazol-2-yl)acetamide represents a class of compounds that are valuable in research and development within the field of organic and medicinal chemistry.
Formula:C6H8N2OS
InChI:InChI=1/C6H8N2OS/c1-4-3-7-6(10-4)8-5(2)9/h3H,1-2H3,(H,7,8,9)
InChI key:VAAPKQNASNXGQY-UHFFFAOYSA-N
SMILES:Cc1cnc(N=C(C)O)s1
Found 4 products.