CAS 620-86-0

Diphenylmethane-4-carboxylic acid

Description:

Diphenylmethane-4-carboxylic acid, with the CAS number 620-86-0, is an organic compound characterized by its structure, which features a diphenylmethane backbone with a carboxylic acid functional group at the para position. This compound typically appears as a white to off-white crystalline solid. It is known for its relatively low solubility in water but can dissolve in organic solvents such as ethanol and acetone. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Diphenylmethane-4-carboxylic acid is utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, and dyes. Its stability under standard conditions makes it a useful compound in research and industrial applications. Additionally, it may exhibit biological activity, although specific pharmacological properties would require further investigation. As with all chemical substances, appropriate safety measures should be taken when handling this compound.

Formula: C₁₄H₁₂O₂

InChI: InChI=1/C14H12O2/c15-14(16)13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10H2,(H,15,16)

SMILES: c1ccc(cc1)Cc1ccc(cc1)C(=O)O

Synonyms:

• 4-Benzylbenzoic Acid

Diphenylmethane-4-carboxylic acid

CAS: 620-86-0

Formula: C₁₄H₁₂O₂

Purity: 98%

Molecular weight: 212.2439

Ref: IN-DA00ECXG

Diphenylmethane-4-carboxylic acid

CAS: 620-86-0

Diphenylmethane-4-carboxylic acid

Molecular weight: 212.24388g/mol

Ref: 54-OR1022051

Diphenylmethane-4-carboxylic acid

CAS: 620-86-0

Diphenylmethane-4-carboxylic acid is a synthetic compound that has been used as a contraceptive. It works by forming a hydrophobic complex with fatty acids in the cell membrane, which prevents the uptake of glyoxal and thiosemicarbazide. Diphenylmethane-4-carboxylic acid has also been shown to be effective in treating cancerous tumors in rats. The formation rate of diphenylmethane-4-carboxylic acid can be increased when it is reacted with citric acid or phosphoric acid in the presence of phosphorus pentoxide. The reaction is catalyzed by sodium hydroxide solution or hydroxide solution.

Formula: C₁₄H₁₂O₂

Purity: Min. 98 Area-%

Color and Shape: Powder

Molecular weight: 212.24 g/mol

Ref: 3D-FD66044

Diphenylmethane-4-carboxylic acid

CAS: 620-86-0

Formula: C₁₄H₁₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 212.248

Ref: 10-F136400