CymitQuimica logo

CAS 62000-97-9

:

Propanoic acid, 2-[(1,2-dihydro-1-oxo-5-isoquinolinyl)oxy]-

Description:
Propanoic acid, 2-[(1,2-dihydro-1-oxo-5-isoquinolinyl)oxy]- is a chemical compound characterized by its propanoic acid backbone, which features a carboxylic acid functional group (-COOH) that imparts acidic properties. The compound includes an isoquinoline moiety, which contributes to its potential biological activity and structural complexity. The presence of the ether linkage (–O–) indicates that it may exhibit unique solubility and reactivity characteristics. Generally, compounds with isoquinoline structures are known for their diverse pharmacological properties, including antimicrobial and anti-inflammatory activities. The molecular structure suggests that this compound may participate in hydrogen bonding due to the carboxylic acid group, influencing its interactions in biological systems. Additionally, the presence of the isoquinoline ring may affect its stability and reactivity under various conditions. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and pharmacology, although specific biological activities would require further investigation.
Formula:C12H11NO4
InChI:InChI=1S/C12H11NO4/c1-7(12(15)16)17-10-4-2-3-9-8(10)5-6-13-11(9)14/h2-7H,1H3,(H,13,14)(H,15,16)
InChI key:FMVZCHNNXNZHBS-UHFFFAOYSA-N
SMILES:CC(C(=O)O)OC1=CC=CC2=C1C=CNC2=O
Found 1 products.