CAS 62002-31-7
:4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine
Description:
4,5,6,7-Tetrahydro-3H-imidazo[4,5-c]pyridine is a bicyclic organic compound characterized by its fused imidazole and pyridine rings. This compound features a saturated tetrahydro structure, which contributes to its unique chemical properties. It typically exhibits a pale yellow to brownish appearance and is soluble in polar organic solvents. The presence of nitrogen atoms in its structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry and drug development. The compound may exhibit various biological activities, including potential neuroprotective or anti-inflammatory effects, although specific biological data may vary. Its molecular structure allows for diverse reactivity, including potential for further functionalization, which can be explored in synthetic organic chemistry. As with many nitrogen-containing heterocycles, it may participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in different environments. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C6H10ClN3
InChI:InChI=1/C6H9N3.ClH/c1-2-7-3-6-5(1)8-4-9-6;/h4,7H,1-3H2,(H,8,9);1H
SMILES:C1CNCc2c1nc[nH]2.Cl
Synonyms:- 4,5,6,7-Tetrahydro-3H-imidazo[4,5-c]pyridinedihydrochloride
- 1H-imidazo[4,5-c]pyridine, 4,5,6,7-tetrahydro-
- 3H-imidazo[4,5-c]pyridine, 4,5,6,7-tetrahydro-
- 4,5,6,7-Tetrahydroimidazolo[4,5-c]pyridine
- Spinaceamine
- 4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine hydrochloride
- 4,5,6,7-Tetrahydro-3H-imidazo[4,5-c]pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4,5,6,7-Tetrahydro-3H-imidazo[4,5-c]pyridine diHCl
CAS:Formula:C6H11Cl2N3Purity:95%Color and Shape:SolidMolecular weight:196.0776Ref: IN-DA003KH0
1g26.00€5g64.00€10g117.00€1kgTo inquire25g160.00€100g593.00€500gTo inquire100mg25.00€250mg25.00€4,5,6,7-Tetrahydro-1H-imidazol[4,5-c]-pyridine dihydrochloride
CAS:4,5,6,7-Tetrahydro-1H-imidazol[4,5-c]-pyridine dihydrochloridePurity:98%Molecular weight:196.08g/molSpinaceamine dihydrochloride
CAS:Spinaceamine dihydrochloride is an organic compound that is useful as a reagent, complex building block, and intermediate for the synthesis of pharmaceuticals. It is also used as a chemical intermediate in the production of fine chemicals, research chemicals, and speciality chemicals. This compound has CAS No. 62002-31-7 and can be used as a versatile building block in organic synthesis due to its ability to undergo reactions with many different functional groups.Formula:C6H9N3•(HCl)2Purity:Min. 95%Molecular weight:196.08 g/mol4,5,6,7-Tetrahydro-3H-imidazo[4,5-c]pyridine dihydrochloride
CAS:Formula:C6H11Cl2N3Purity:95%Color and Shape:SolidMolecular weight:196.084,5,6,7-Tetrahydro-3H-imidazo[4,5-c]pyridine Dihydrochloride
CAS:Controlled ProductApplications 4,5,6,7-Tetrahydro-3H-imidazo[4,5-c]pyridine dihydrochloride (cas# 62002-31-7) is a useful research chemical.
Formula:C6H9N3HClColor and Shape:NeatMolecular weight:196.078




