CAS 62008-22-4
:2-Butenedioic acid (2E)-, 1-ethyl ester, calcium salt (2:1)
Description:
2-Butenedioic acid (2E)-, 1-ethyl ester, calcium salt (2:1), commonly known as calcium 2-butenoate, is a calcium salt derived from the esterification of 2-butenedioic acid with ethanol. This compound typically appears as a white to off-white solid and is soluble in water, which is a characteristic feature of many salts. It is often used in agricultural applications, particularly as a fertilizer or soil amendment, due to its role in providing essential nutrients to plants. The calcium component contributes to soil structure and plant health, while the butenedioic acid moiety can influence plant metabolism. The compound is generally considered to have low toxicity, making it suitable for use in various environmental applications. Its stability under normal conditions allows for effective storage and handling. As with many chemical substances, proper safety measures should be observed during handling to avoid any potential hazards. Overall, this compound plays a significant role in enhancing agricultural productivity and soil quality.
Formula:C6H8O4Ca
InChI:InChI=1S/C6H8O4.Ca/c1-2-10-6(9)4-3-5(7)8;/h3-4H,2H2,1H3,(H,7,8);/b4-3+;
InChI key:InChIKey=SJXIAQOYWJYMTN-BJILWQEISA-N
SMILES:C(/C=C/C(O)=O)(OCC)=O.[Ca]
Synonyms:- 2-Butenedioic acid (2E)-, 1-ethyl ester, calcium salt (2:1)
- 2-Butenedioic acid (2E)-, monoethyl ester, calcium salt
- 2-Butenedioic acid (E)-, monoethyl ester, calcium salt
- Bis[[4-ethoxy-4-oxobut-2-enoyl]oxy]calcium
- Calcium monoethylfumarate
- Monoethyl fumarate calcium salt
- calcium bis[(2E)-4-ethoxy-4-oxobut-2-enoate]
- Fumaric acid monoethyl ester calcium salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.
Monoethyl Fumarate Calcium
CAS:Controlled ProductFormula:C6H7O4·CaColor and Shape:NeatMolecular weight:326.31Fumaric Acid Monoethyl Ester Calcium Salt
CAS:Controlled ProductFormula:C6H7O4·CaColor and Shape:NeatMolecular weight:326.31




