CAS 6201-86-1
:3-Amino-2-hydroxy-5-sulfobenzoic acid
Description:
3-Amino-2-hydroxy-5-sulfobenzoic acid, also known as sulfanilic acid, is an aromatic sulfonic acid characterized by the presence of an amino group (-NH2), a hydroxyl group (-OH), and a sulfonic acid group (-SO3H) attached to a benzene ring. This compound is typically a white to light yellow crystalline solid that is soluble in water, reflecting its polar functional groups. It exhibits acidic properties due to the sulfonic acid group, which can donate protons in solution. The amino group contributes to its basicity, allowing it to participate in various chemical reactions, including diazotization, which is significant in dye synthesis. Additionally, the hydroxyl group can engage in hydrogen bonding, enhancing its solubility and reactivity. 3-Amino-2-hydroxy-5-sulfobenzoic acid is often used in the production of azo dyes and as a reagent in analytical chemistry. Its structural features make it a versatile compound in both industrial and laboratory settings.
Formula:C7H7NO6S
InChI:InChI=1S/C7H7NO6S/c8-5-2-3(15(12,13)14)1-4(6(5)9)7(10)11/h1-2,9H,8H2,(H,10,11)(H,12,13,14)
InChI key:InChIKey=ZLTOYIGWKLTQBJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(S(=O)(=O)O)=CC(N)=C1O
Synonyms:- 3-Amino-2-Hydroxy-5-Sulfobenzoic Acid
- 3-Amino-4-hydroxy-5-carboxybenzenesulfonic acid
- 3-Amino-5-sulfosalicylic acid
- Benzoic acid, 3-amino-2-hydroxy-5-sulfo-
- Salicylic acid, 3-amino-5-sulfo-
- 3-Amino-5-sulphosalicylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
