CAS 62014-87-3
:Helichrysetin
Description:
Helichrysetin, with the CAS number 62014-87-3, is a naturally occurring flavonoid compound primarily derived from various plant sources, particularly those in the Asteraceae family. It is characterized by its yellow pigment, which is often associated with its role in plant coloration and UV protection. Helichrysetin exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. The compound typically features a flavone structure, which includes a chromone backbone with hydroxyl groups that contribute to its reactivity and solubility in organic solvents. Its stability and low toxicity further enhance its appeal for potential applications in nutraceuticals and cosmetics. Additionally, ongoing studies are exploring its mechanisms of action and efficacy in various therapeutic contexts, highlighting the importance of natural products in drug discovery and development.
Formula:C16H14O5
InChI:InChI=1S/C16H14O5/c1-21-15-9-12(18)8-14(20)16(15)13(19)7-4-10-2-5-11(17)6-3-10/h2-9,17-18,20H,1H3/b7-4+
InChI key:InChIKey=OWGUBYRKZATRIT-QPJJXVBHSA-N
SMILES:C(/C=C/C1=CC=C(O)C=C1)(=O)C2=C(OC)C=C(O)C=C2O
Synonyms:- (2E)-1-(2,4-Dihydroxy-6-methoxyphenyl)-3-(4-hydroxyphenyl)-2-propen-1-one
- 1-(2,4-Dihydroxy-6-methoxyphenyl)-3-(4-hydroxyphenyl)-2-propen-1-one
- 2-Propen-1-one, 1-(2,4-dihydroxy-6-methoxyphenyl)-3-(4-hydroxyphenyl)-
- 2-Propen-1-one, 1-(2,4-dihydroxy-6-methoxyphenyl)-3-(4-hydroxyphenyl)-, (2E)-
- 2-Propen-1-one, 1-(2,4-dihydroxy-6-methoxyphenyl)-3-(4-hydroxyphenyl)-, (E)-
- 4,2′,4′-Trihydroxy-6′-methoxychalcone
- Helichrysetin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Helichrysetin
CAS:HelichrysetinFormula:C16H14O5Purity:≥95%Color and Shape:SolidMolecular weight:286.28Helichrysetin
CAS:Formula:C16H14O5Purity:95%~99%Color and Shape:Yellow powderMolecular weight:286.283Helichrysetin
CAS:Helichrysetin shows mild anti-HIV-1 activity and potential as an anticancer agent with cytotoxic effects on A549, MCF-7, Ca Ski, HT-29 cells.Formula:C16H14O5Purity:96.32% - ≥95%Color and Shape:SolidMolecular weight:286.28Helichrysetin
CAS:Helichrysetin is a natural compound that has been shown to inhibit the production of TNF-α in activated human epidermal cells. It also has protease activity and can cause cell lysis. Helichrysetin is an acetate extract from the plant Helichrysum italicum. It can be used as a potential anticancer agent, as it has been shown to induce apoptosis in human cervical cancer cells. The mechanism by which helichrysetin induces apoptosis may be due to its ability to reduce mitochondrial membrane potential and activate caspases.END>Formula:C16H14O5Purity:Min. 95%Molecular weight:286.28 g/mol







