CAS 62016-18-6
:5-ethyl-2-methyloctane
Description:
5-Ethyl-2-methyloctane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. Its molecular formula is C10H22, indicating it consists of ten carbon atoms and twenty-two hydrogen atoms. This compound features a straight-chain octane backbone with an ethyl group attached to the fifth carbon and a methyl group on the second carbon, contributing to its branched structure. As a saturated hydrocarbon, 5-ethyl-2-methyloctane is characterized by its relatively low reactivity, typical of alkanes, and it is non-polar, making it insoluble in water but soluble in organic solvents. It has a relatively high boiling point compared to smaller alkanes due to increased molecular weight and surface area, which enhances van der Waals forces. This compound is primarily used in research and industrial applications, particularly in the study of hydrocarbon behavior and as a reference compound in various chemical analyses. Its physical properties, such as density and viscosity, are influenced by its branched structure, which can affect its performance as a fuel or solvent.
Formula:C11H24
InChI:InChI=1/C11H24/c1-5-7-11(6-2)9-8-10(3)4/h10-11H,5-9H2,1-4H3
Synonyms:- octane, 5-ethyl-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
