CAS 620176-90-1
:1-(6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-yl)ethanone
Description:
1-(6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-yl)ethanone, with the CAS number 620176-90-1, is a chemical compound characterized by its unique structure that includes a benzopyran moiety and a fluorine substituent. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the fluorine atom enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The benzopyran structure is known for its occurrence in various natural products and its potential pharmacological properties, including antioxidant and anti-inflammatory activities. Additionally, the dihydro form indicates that the compound may exist in a cyclic form, which can affect its stability and interactions with other molecules. Overall, this compound's characteristics suggest it could be valuable in drug development or as a synthetic intermediate in the production of more complex chemical entities.
Formula:C11H11FO2
InChI:InChI=1S/C11H11FO2/c1-7(13)10-4-2-8-6-9(12)3-5-11(8)14-10/h3,5-6,10H,2,4H2,1H3
InChI key:InChIKey=ODAHUOSPKOMSBG-UHFFFAOYSA-N
SMILES:C(C)(=O)C1OC=2C(=CC(F)=CC2)CC1
Synonyms:- Ethanone, 1-(6-fluoro-3,4-dihydro-2H-1-benzopyran-2-yl)-
- 1-(6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-yl)ethanone
- 1-(6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-yl)ethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
