CAS 62022-04-2

Ethyl 2,4-dichloronicotinate

Description:

Ethyl 2,4-dichloronicotinate is an organic compound that belongs to the class of nicotinic acid derivatives. It features a pyridine ring substituted with two chlorine atoms at the 2 and 4 positions and an ethyl ester group. This compound is typically characterized by its moderate polarity, which allows it to dissolve in various organic solvents while being less soluble in water. Ethyl 2,4-dichloronicotinate exhibits biological activity, making it of interest in pharmaceutical and agricultural research, particularly for its potential use as an insecticide or herbicide. Its structure contributes to its reactivity, allowing for various chemical transformations. The compound's stability under standard conditions is generally good, although it may be sensitive to strong acids or bases. Safety data should be consulted for handling and exposure guidelines, as with many chlorinated compounds, it may pose environmental and health risks. Overall, Ethyl 2,4-dichloronicotinate is a compound of interest due to its unique chemical properties and potential applications in various fields.

Formula: C₈H₇Cl₂NO₂

InChI: InChI=1/C8H7Cl2NO2/c1-2-13-8(12)6-5(9)3-4-11-7(6)10/h3-4H,2H2,1H3

SMILES: CCOC(=O)c1c(ccnc1Cl)Cl

Synonyms:

• 3-Pyridinecarboxylic Acid, 2,4-Dichloro-, Ethyl Ester
• 2,4-Dichloro-nicotinic acid ethyl ester
• Ethyl 2,4-dichloronicotinate
• 2,4-dichloro-5-ethylpyridine-3-carboxylic acid

Ethyl 2,4-dichloronicotinate

CAS: 62022-04-2

Formula: C₈H₇Cl₂NO₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 220.0527

Ref: IN-DA00EICG

Ethyl 2,4-dichloronicotinate

CAS: 62022-04-2

Ethyl 2,4-dichloronicotinate

Purity: 98%

Molecular weight: 220.05268g/mol

Ref: 54-OR303797

Ethyl 2,4-dichloronicotinate

CAS: 62022-04-2

Formula: C₈H₇Cl₂NO₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 220.05

Ref: 10-F093364