CAS 62023-61-4
:(αR,βR)-β-Amino-α-hydroxybenzenebutanoic acid
Description:
(αR,βR)-β-Amino-α-hydroxybenzenebutanoic acid, also known as a specific amino acid derivative, is characterized by its structural features that include an amino group, a hydroxyl group, and a phenyl ring. This compound is a chiral molecule, meaning it exists in two enantiomeric forms, which can exhibit different biological activities. The presence of both the amino and hydroxyl groups contributes to its potential as a building block in peptide synthesis and as a ligand in various biochemical applications. Its molecular structure allows for interactions with biological systems, making it of interest in pharmaceutical research. The compound is typically soluble in polar solvents, and its stability can be influenced by pH and temperature. Additionally, its unique stereochemistry may affect its interaction with enzymes and receptors, which is crucial for its function in biological contexts. Overall, (αR,βR)-β-Amino-α-hydroxybenzenebutanoic acid is a compound of interest in both synthetic and medicinal chemistry due to its functional groups and chiral nature.
Formula:C10H13NO3
InChI:InChI=1S/C10H13NO3/c11-8(9(12)10(13)14)6-7-4-2-1-3-5-7/h1-5,8-9,12H,6,11H2,(H,13,14)/t8-,9-/m1/s1
InChI key:InChIKey=LDSJMFGYNFIFRK-RKDXNWHRSA-N
SMILES:C([C@H]([C@H](C(O)=O)O)N)C1=CC=CC=C1
Synonyms:- Benzenebutanoic acid, β-amino-α-hydroxy-, [R-(R*,R*)]-
- (αR,βR)-β-Amino-α-hydroxybenzenebutanoic acid
- Benzenebutanoic acid, β-amino-α-hydroxy-, (αR,βR)-
- (2R,3R)-3-Amino-2-hydroxy-4-phenylbutanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
