CAS 62023-90-9

Juncusol

Description:

Juncusol, with the CAS number 62023-90-9, is a chemical compound derived from the plant genus Juncus, commonly known as rushes. It is primarily recognized for its potential biological activities, including antimicrobial and anti-inflammatory properties. Juncusol is characterized by its unique molecular structure, which contributes to its reactivity and interaction with biological systems. The compound is often studied for its phytochemical constituents, which may include flavonoids and other secondary metabolites that enhance its therapeutic potential. In terms of solubility, Juncusol may exhibit varying degrees of solubility in polar and non-polar solvents, influencing its application in pharmaceutical formulations. Additionally, its stability and reactivity can be affected by environmental factors such as pH and temperature. Research into Juncusol continues to explore its efficacy in various medicinal applications, highlighting the importance of natural products in drug discovery and development.

Formula: C₁₈H₁₈O₂

InChI: InChI=1S/C18H18O2/c1-4-13-10(2)17(20)9-12-5-6-14-11(3)16(19)8-7-15(14)18(12)13/h4,7-9,19-20H,1,5-6H2,2-3H3

InChI key: InChIKey=XNVMKPYDOHZJLR-UHFFFAOYSA-N

SMILES: C(=C)C1=C2C=3C(CCC2=CC(O)=C1C)=C(C)C(O)=CC3

Synonyms:

• 1,6-Dimethyl-5-vinyl-9,10-dihydrophenanthrene-2,7-diol
• 2,7-Dihydroxy-1,6-dimethyl-5-vinyl-9,10-dihydrophenanthrene
• 2,7-Phenanthrenediol, 5-Ethenyl-9,10-Dihydro-1,6-Dimethyl-
• 5-Ethenyl-9,10-dihydro-1,6-dimethyl-2,7-phenanthrenediol
• Juncusol
• NSC 220968

Juncusol

CAS: 62023-90-9

Formula: C₁₈H₁₈O₂

Purity: 98.0%

Molecular weight: 266.3343

Ref: IN-DA00EI6B

Juncusol

CAS: 62023-90-9

Juncusol

Purity: ≥98%

Molecular weight: 266.33g/mol

Ref: 54-BUP20043

Juncusol

CAS: 62023-90-9

Juncusol is a phenolic compound that can be isolated from Juncus roemerianus, a species of black needle grass, and has anti-anxiety activity.

Formula: C₁₈H₁₈O₂

Purity: 99.36%

Color and Shape: Solid

Molecular weight: 266.33

Ref: TM-TN1814

Juncusol

CAS: 62023-90-9

Formula: C₁₈H₁₈O₂

Purity: 95%~99%

Molecular weight: 266.34

Ref: BP-BP3628

Juncusol

CAS: 62023-90-9

Juncusol is an organic compound derived from the plant species Juncus, which is a genus of rushes commonly found in wetlands and marshlands. It is characterized as a natural phenanthrene derivative, which is unique to its botanical source. The mode of action of Juncusol involves interference with specific cellular pathways, potentially leading to anti-inflammatory or antimicrobial effects, though the exact mechanisms at the molecular level are still under investigation.

Formula: C₁₈H₁₈O₂

Purity: Min. 95%

Molecular weight: 266.34 g/mol

Ref: 3D-MCA02390