CAS 62025-50-7
:Ginsenoside F3
Description:
Ginsenoside F3 is a triterpenoid saponin primarily derived from ginseng, a plant known for its medicinal properties. It is part of a larger group of ginsenosides, which are bioactive compounds contributing to the pharmacological effects of ginseng. Ginsenoside F3 is characterized by its complex molecular structure, which includes a steroid-like backbone with various sugar moieties attached, influencing its solubility and biological activity. This compound is known for its potential health benefits, including anti-inflammatory, antioxidant, and neuroprotective effects. Research suggests that ginsenoside F3 may play a role in modulating immune responses and promoting cognitive function. Its mechanism of action often involves interaction with various cellular pathways, making it a subject of interest in pharmacological studies. As with many natural products, the efficacy and safety of ginsenoside F3 depend on factors such as dosage, formulation, and individual health conditions. Further studies are ongoing to fully elucidate its therapeutic potential and mechanisms of action.
Formula:C41H70O13
InChI:InChI=1S/C41H70O13/c1-20(2)10-9-13-41(8,54-36-33(50)31(48)30(47)25(53-36)19-52-35-32(49)29(46)24(44)18-51-35)21-11-15-39(6)28(21)22(42)16-26-38(5)14-12-27(45)37(3,4)34(38)23(43)17-40(26,39)7/h10,21-36,42-50H,9,11-19H2,1-8H3/t21-,22+,23-,24-,25+,26+,27-,28-,29-,30+,31-,32+,33+,34-,35-,36-,38+,39+,40+,41-/m0/s1
InChI key:InChIKey=HJRVLGWTJSLQIG-ABNMXWHVSA-N
SMILES:C[C@]12[C@@]3(C)[C@@]([C@@]([C@@](O[C@@H]4O[C@H](CO[C@H]5[C@H](O)[C@@H](O)[C@@H](O)CO5)[C@@H](O)[C@H](O)[C@H]4O)(CCC=C(C)C)C)(CC3)[H])([C@H](O)C[C@@]1([C@]6(C)[C@@]([C@@H](O)C2)(C(C)(C)[C@@H](O)CC6)[H])[H])[H]
Synonyms:- Dammarane, β-D-glucopyranoside deriv.
- β-D-Glucopyranoside, (3β,6α,12β)-3,6,12-trihydroxydammar-24-en-20-yl 6-O-α-L-arabinopyranosyl-
- (3β,6α,12β)-3,6,12-Trihydroxydammar-24-en-20-yl 6-O-α-L-arabinopyranosyl-β-D-glucopyranoside
- Ginsenoside F3
- (3β,6α,12β)-3,6,12-Trihydroxydammar-24-en-20-yl 6-O-α-L-arabinopy ranosyl-β-D-glucopyranoside
- 3β,6α,12β-Trihydroxy-5α-dammar-24-en-20-yl 6-O-α-L-arabinopyranosyl-β-D-glucopyranoside
- (20S)-20-(6-O-α-L-Arabinopyranosyl-β-D-glucopyranosyloxy)-5α-dammara-24-ene-3β,6α,12β-triol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ginsenoside F3
CAS:Ginsenoside-F3 has immunoenhancing activity by regulating production and gene expression of type 1, type 2 cytokines in murine spleen cells.Formula:C41H70O13Purity:99.84% - 99.95%Color and Shape:SolidMolecular weight:770.99Ginsenoside F3
CAS:Ginsenoside F3 is a bioactive compound, specifically a saponin, which is extracted from the roots of Panax ginseng, a perennial plant widely studied for its medicinal properties. This compound is of significant interest in the field of pharmacology due to its multifaceted mode of action at the cellular level. Ginsenoside F3 is known to modulate various signaling pathways, including those involved in immune response, apoptosis, and anti-inflammatory processes. Its ability to interact with cellular receptors and enzymes makes it a potent candidate for therapeutic applications.Formula:C41H70O13Purity:Min. 95%Molecular weight:770.99 g/mol






