CAS 62029-79-2

2-(ethylamino)-2-oxoethanaminium

Description:

2-(Ethylamino)-2-oxoethanaminium, with the CAS number 62029-79-2, is an organic compound characterized by its amine and carbonyl functional groups. This substance typically appears as a white to off-white solid or crystalline material. It is soluble in water due to the presence of the amino group, which can engage in hydrogen bonding. The compound is likely to exhibit basic properties due to the ethylamino group, allowing it to act as a proton acceptor. Its structure suggests potential applications in pharmaceuticals or as a biochemical reagent, particularly in the synthesis of more complex molecules. Additionally, the presence of the oxo group indicates that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 2-(ethylamino)-2-oxoethanaminium is a versatile compound with potential utility in various chemical and biological contexts.

Formula: C₄H₁₁N₂O

InChI: InChI=1/C4H10N2O/c1-2-6-4(7)3-5/h2-3,5H2,1H3,(H,6,7)/p+1

2-Amino-N-ethylacetamide

CAS: 62029-79-2

Formula: C₄H₁₀N₂O

Purity: 98%

Color and Shape: Liquid

Molecular weight: 102.1350

Ref: IN-DA00EKLI

2-Amino-N-ethylacetamide

CAS: 62029-79-2

2-Amino-N-ethylacetamide

Purity: 98%

Molecular weight: 102.14g/mol

Ref: 54-OR1043284

2-Amino-N-ethylacetamide

CAS: 62029-79-2

Formula: C₄H₁₀N₂O

Purity: 98%

Molecular weight: 102.137

Ref: 10-F075036