CAS 62031-97-4

5-methyl-5-(thiophen-2-yl)imidazolidine-2,4-dione

Description:

5-Methyl-5-(thiophen-2-yl)imidazolidine-2,4-dione, with the CAS number 62031-97-4, is a heterocyclic organic compound characterized by its imidazolidine ring structure, which contains two carbonyl groups (diones) and a methyl group at the 5-position. The presence of a thiophene ring at the 5-position introduces aromatic characteristics and enhances the compound's potential for various chemical interactions. This compound is typically solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its unique structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The presence of both the imidazolidine and thiophene moieties may impart interesting biological activities, making it a subject of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the electron-donating and withdrawing effects of the substituents on the ring systems, which can be explored further in synthetic and application studies.

Formula: C₈H₈N₂O₂S

InChI: InChI=1/C8H8N2O2S/c1-8(5-3-2-4-13-5)6(11)9-7(12)10-8/h2-4H,1H3,(H2,9,10,11,12)

SMILES: CC1(c2cccs2)C(=NC(=N1)O)O

Synonyms:

• 5-Methyl-5-Thien-2-Ylimidazolidine-2,4-Dione

5-Methyl-5-(thiophen-2-yl)imidazolidine-2,4-dione

CAS: 62031-97-4

Versatile small molecule scaffold

Formula: C₈H₈N₂O₂S

Purity: Min. 95%

Molecular weight: 196.23 g/mol

Ref: 3D-MCA03197