CAS 62039-14-9
:1-cyclohexyl-2,2-dimethylpropan-1-ol
Description:
1-Cyclohexyl-2,2-dimethylpropan-1-ol, with the CAS number 62039-14-9, is an organic compound characterized by its unique structure, which includes a cyclohexyl group and a branched alcohol functional group. This compound is a tertiary alcohol, meaning that the hydroxyl (-OH) group is attached to a carbon atom that is connected to three other carbon atoms. Its molecular structure contributes to its physical properties, such as a relatively high boiling point compared to simpler alcohols due to the presence of the bulky cyclohexyl and dimethyl groups, which also influence its solubility in various solvents. The compound is likely to exhibit moderate polarity, making it soluble in polar solvents while having some hydrophobic characteristics due to the cyclohexyl ring. Additionally, it may participate in hydrogen bonding due to the hydroxyl group, affecting its reactivity and interactions with other chemical species. Overall, 1-cyclohexyl-2,2-dimethylpropan-1-ol is of interest in organic synthesis and may have applications in various chemical processes.
Formula:C11H22O
InChI:InChI=1/C11H22O/c1-11(2,3)10(12)9-7-5-4-6-8-9/h9-10,12H,4-8H2,1-3H3
SMILES:CC(C)(C)C(C1CCCCC1)O
Synonyms:- 1-Cyclohexyl-2,2-dimethyl-1-propanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Cyclohexyl-2,2-dimethylpropan-1-ol
CAS:Controlled ProductFormula:C11H22OColor and Shape:NeatMolecular weight:170.292
