CAS 62052-49-7

6-methyl-1,3-benzodioxol-5-amine

Description:

6-Methyl-1,3-benzodioxol-5-amine, with the CAS number 62052-49-7, is an organic compound characterized by its unique structure that includes a benzodioxole moiety and an amine functional group. This compound features a methyl group at the 6-position of the benzodioxole ring, which contributes to its chemical properties and potential biological activity. It is typically a white to off-white solid, and its solubility can vary depending on the solvent used, often being more soluble in polar organic solvents. The presence of the amine group suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound is of interest in various fields, including medicinal chemistry, due to its potential pharmacological properties. However, specific applications and biological effects would require further investigation through empirical studies. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles.

Formula: C₈H₉NO₂

InChI: InChI=1/C8H9NO2/c1-5-2-7-8(3-6(5)9)11-4-10-7/h2-3H,4,9H2,1H3

SMILES: Cc1cc2c(cc1N)OCO2

Synonyms:

• 1,3-Benzodioxol-5-Amine, 6-Methyl-

(6-Methyl-1,3-benzodioxol-5-yl)amine

CAS: 62052-49-7

Formula: C₈H₉NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 151.1626

Ref: IN-DA00EC22

6-Methylbenzo[d][1,3]dioxol-5-amine

CAS: 62052-49-7

6-Methylbenzo[d][1,3]dioxol-5-amine

Purity: 97%

Molecular weight: 151.16g/mol

Ref: 54-OR1036176

(6-Methyl-1,3-benzodioxol-5-yl)amine

CAS: 62052-49-7

Formula: C₈H₉NO₂

Purity: 97%

Molecular weight: 151.165

Ref: 10-F075442