CymitQuimica logo

CAS 620607-24-1

:

acenaphthen-5-yl-bromo-magnesium

Description:
Acenaphthen-5-yl-bromo-magnesium is an organomagnesium compound, typically classified as a Grignard reagent. Grignard reagents are characterized by the presence of a carbon-magnesium bond, which is highly reactive and plays a crucial role in organic synthesis, particularly in forming carbon-carbon bonds. The compound features an acenaphthene moiety, which is a bicyclic aromatic hydrocarbon, contributing to its unique reactivity and stability. The bromine atom in the structure serves as a leaving group, facilitating nucleophilic attacks in various reactions. As with many Grignard reagents, it is sensitive to moisture and air, requiring an anhydrous environment for storage and handling. This compound can be utilized in the synthesis of complex organic molecules, including pharmaceuticals and agrochemicals, by reacting with various electrophiles. Its reactivity and the ability to form new carbon-carbon bonds make it a valuable tool in synthetic organic chemistry. Proper safety precautions should be taken when working with this compound due to its reactivity and potential hazards associated with organometallic compounds.
Formula:C12H9BrMg
InChI:InChI=1/C12H9.BrH.Mg/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11;;/h1-3,5-6H,7-8H2;1H;/q;;+1/p-1/rC12H9BrMg/c13-14-11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-3,6-7H,4-5H2
SMILES:C1=CC2=C=CC=C3CCC(=C1)C23.Br.[Mg]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.