CAS 62064-69-1

2-(4-fluorophenyl)-2-methoxyethanamine hydrochloride

Description:

2-(4-Fluorophenyl)-2-methoxyethanamine hydrochloride, with the CAS number 62064-69-1, is a chemical compound that belongs to the class of substituted phenethylamines. It features a fluorinated phenyl group, which enhances its lipophilicity and may influence its biological activity. The presence of the methoxy group contributes to its structural complexity and can affect its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including research in pharmacology and medicinal chemistry. The compound may exhibit psychoactive properties, similar to other phenethylamines, and is of interest in the study of neurotransmitter systems. Its synthesis and characterization involve standard organic chemistry techniques, and it is essential to handle it with care due to potential biological effects. Safety data sheets should be consulted for proper handling and disposal guidelines. Overall, this compound represents a significant area of interest for researchers exploring the pharmacological potential of phenethylamine derivatives.

Formula: C₉H₁₃ClFNO

InChI: InChI=1/C9H12FNO.ClH/c1-12-9(6-11)7-2-4-8(10)5-3-7;/h2-5,9H,6,11H2,1H3;1H

SMILES: COC(CN)c1ccc(cc1)F.Cl

2-(4-Fluorophenyl)-2-methoxyethan-1-amine hydrochloride

Controlled Product

CAS: 62064-69-1

Versatile small molecule scaffold

Formula: C₉H₁₃ClFNO

Purity: Min. 95%

Molecular weight: 205.66 g/mol

Ref: 3D-MCA06469