CAS 62064-77-1

1-(4-fluorophenyl)-1-methoxypropan-2-amine hydrochloride

Description:

1-(4-Fluorophenyl)-1-methoxypropan-2-amine hydrochloride, identified by its CAS number 62064-77-1, is a chemical compound that belongs to the class of substituted phenethylamines. This substance features a propan-2-amine backbone with a methoxy group and a fluorophenyl substituent, which contributes to its unique properties. The presence of the fluorine atom can enhance lipophilicity and influence the compound's biological activity. As a hydrochloride salt, it is typically more soluble in water, which is advantageous for various applications, including pharmacological studies. The compound may exhibit stimulant or psychoactive effects, similar to other phenethylamines, but its specific pharmacodynamics and toxicity profile would require further investigation. In laboratory settings, it is essential to handle this compound with care, adhering to safety protocols due to potential health risks associated with its use. Overall, 1-(4-fluorophenyl)-1-methoxypropan-2-amine hydrochloride is of interest in medicinal chemistry and research contexts, particularly in the exploration of novel therapeutic agents.

Formula: C₁₀H₁₅ClFNO

InChI: InChI=1/C10H14FNO.ClH/c1-7(12)10(13-2)8-3-5-9(11)6-4-8;/h3-7,10H,12H2,1-2H3;1H

SMILES: CC(C(c1ccc(cc1)F)OC)N.Cl

1-(4-Fluorophenyl)-1-methoxypropan-2-amine hydrochloride

Controlled Product

CAS: 62064-77-1

Versatile small molecule scaffold

Formula: C₁₀H₁₅ClFNO

Purity: Min. 95%

Molecular weight: 219.68 g/mol

Ref: 3D-MCA06477